C14H20N2O4 — CID 27305991
(2R)-2-(2-hydroxyethylamino)-4-oxo-4-[[(1S)-1-phenylethyl]amino]butanoic acid (PubChem CID 27305991) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (2R)-2-(2-hydroxyethylamino)-4-oxo-4-[[(1S)-1-phenylethyl]amino]butanoic acid.
| Compound Name | (2R)-2-(2-hydroxyethylamino)-4-oxo-4-[[(1S)-1-phenylethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 27305991 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (2R)-2-(2-hydroxyethylamino)-4-oxo-4-[[(1S)-1-phenylethyl]amino]butanoic acid |
| SMILES | C[C@H](NC(=O)C[C@@H](NCCO)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C14H20N2O4/c1-10(11-5-3-2-4-6-11)16-13(18)9-12(14(19)20)15-7-8-17/h2-6,10,12,15,17H,7-9H2,1H3,(H,16,18)(H,19,20)/t10-,12+/m0/s1 |
| InChIKey | QLNSYTMSXJSFRR-CMPLNLGQSA-N |
| XLogP | 0.29 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |