C21H23ClN2OS — CID 27335326
3-chloro-N-[[2-(diethylaminomethyl)phenyl]methyl]-1-benzothiophene-2-carboxamide (PubChem CID 27335326) has the molecular formula C21H23ClN2OS and a molecular weight of 386.95 g/mol. Its IUPAC name is 3-chloro-N-[[2-(diethylaminomethyl)phenyl]methyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[[2-(diethylaminomethyl)phenyl]methyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 27335326 |
| Molecular Formula | C21H23ClN2OS |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 3-chloro-N-[[2-(diethylaminomethyl)phenyl]methyl]-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)Cc1ccccc1CNC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C21H23ClN2OS/c1-3-24(4-2)14-16-10-6-5-9-15(16)13-23-21(25)20-19(22)17-11-7-8-12-18(17)26-20/h5-12H,3-4,13-14H2,1-2H3,(H,23,25) |
| InChIKey | VHQKPZMGTKQGDH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |