C22H26N4O4S2 — CID 27353183
4-[4-[2-[[5-(4-ethylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]sulfonylmorpholine (PubChem CID 27353183) has the molecular formula C22H26N4O4S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 4-[4-[2-[[5-(4-ethylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]sulfonylmorpholine.
| Compound Name | 4-[4-[2-[[5-(4-ethylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 27353183 |
| Molecular Formula | C22H26N4O4S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 4-[4-[2-[[5-(4-ethylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]phenyl]sulfonylmorpholine |
| SMILES | CCc1ccc(-c2nc(SCCOc3ccc(S(=O)(=O)N4CCOCC4)cc3)n[nH]2)cc1 |
| InChI | InChI=1S/C22H26N4O4S2/c1-2-17-3-5-18(6-4-17)21-23-22(25-24-21)31-16-15-30-19-7-9-20(10-8-19)32(27,28)26-11-13-29-14-12-26/h3-10H,2,11-16H2,1H3,(H,23,24,25) |
| InChIKey | NOQYUASXOHDFRF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|