C11H12N4O3S2 — CID 27376471
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-methoxy-4-oxo-1H-pyridine-2-carboxamide (PubChem CID 27376471) has the molecular formula C11H12N4O3S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-methoxy-4-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-methoxy-4-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 27376471 |
| Molecular Formula | C11H12N4O3S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-methoxy-4-oxo-1H-pyridine-2-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2cc(=O)c(OC)c[nH]2)s1 |
| InChI | InChI=1S/C11H12N4O3S2/c1-3-19-11-15-14-10(20-11)13-9(17)6-4-7(16)8(18-2)5-12-6/h4-5H,3H2,1-2H3,(H,12,16)(H,13,14,17) |
| InChIKey | ODUWHDVRJYCRIS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|