C9H7Br2N3OS3 — CID 19219392
4,5-dibromo-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide (PubChem CID 19219392) has the molecular formula C9H7Br2N3OS3 and a molecular weight of 429.18 g/mol. Its IUPAC name is 4,5-dibromo-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | 4,5-dibromo-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19219392 |
| Molecular Formula | C9H7Br2N3OS3 |
| Molecular Weight | 429.18 g/mol |
| Exact Mass | 426.81 |
| IUPAC Name | 4,5-dibromo-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2cc(Br)c(Br)s2)s1 |
| InChI | InChI=1S/C9H7Br2N3OS3/c1-2-16-9-14-13-8(18-9)12-7(15)5-3-4(10)6(11)17-5/h3H,2H2,1H3,(H,12,13,15) |
| InChIKey | OVLMFUXKCPHNNK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.18 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|