C14H15N5OS — CID 27377839
4-methyl-6-[3-(2-phenoxyethylsulfanyl)diazirin-1-yl]pyrimidin-2-amine (PubChem CID 27377839) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is 4-methyl-6-[3-(2-phenoxyethylsulfanyl)diazirin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-methyl-6-[3-(2-phenoxyethylsulfanyl)diazirin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 27377839 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-methyl-6-[3-(2-phenoxyethylsulfanyl)diazirin-1-yl]pyrimidin-2-amine |
| SMILES | Cc1cc(N2N=C2SCCOc2ccccc2)nc(N)n1 |
| InChI | InChI=1S/C14H15N5OS/c1-10-9-12(17-13(15)16-10)19-14(18-19)21-8-7-20-11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H2,15,16,17) |
| InChIKey | RNQMAHCSRGSJGP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|