C18H24N2 — CID 2737895
spiro[5,6a,7,8,9,10-hexahydrobenzo[b][1,4]benzodiazepine-6,1'-cyclohexane] (PubChem CID 2737895) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is spiro[5,6a,7,8,9,10-hexahydrobenzo[b][1,4]benzodiazepine-6,1'-cyclohexane].
| Compound Name | spiro[5,6a,7,8,9,10-hexahydrobenzo[b][1,4]benzodiazepine-6,1'-cyclohexane] |
|---|---|
| PubChem CID | 2737895 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | spiro[5,6a,7,8,9,10-hexahydrobenzo[b][1,4]benzodiazepine-6,1'-cyclohexane] |
| SMILES | c1ccc2c(c1)N=C1CCCCC1C1(CCCCC1)N2 |
| InChI | InChI=1S/C18H24N2/c1-6-12-18(13-7-1)14-8-2-3-9-15(14)19-16-10-4-5-11-17(16)20-18/h4-5,10-11,14,20H,1-3,6-9,12-13H2 |
| InChIKey | ZCIXBADAXFZHGV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |