C13H12F3NO3S — CID 2740148
methyl 2-[(Z)-1,1,1-trifluoro-4-hydroxyimino-3-phenylbut-2-en-2-yl]sulfanylacetate (PubChem CID 2740148) has the molecular formula C13H12F3NO3S and a molecular weight of 319.30 g/mol. Its IUPAC name is methyl 2-[(Z)-1,1,1-trifluoro-4-hydroxyimino-3-phenylbut-2-en-2-yl]sulfanylacetate.
| Compound Name | methyl 2-[(Z)-1,1,1-trifluoro-4-hydroxyimino-3-phenylbut-2-en-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 2740148 |
| Molecular Formula | C13H12F3NO3S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | methyl 2-[(Z)-1,1,1-trifluoro-4-hydroxyimino-3-phenylbut-2-en-2-yl]sulfanylacetate |
| SMILES | COC(=O)CS/C(=C(\C=NO)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO3S/c1-20-11(18)8-21-12(13(14,15)16)10(7-17-19)9-5-3-2-4-6-9/h2-7,19H,8H2,1H3/b12-10+,17-7? |
| InChIKey | BMELLFVHPJUHQX-HYJOMVEBSA-N |
| XLogP | 3.33 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|