C22H22N2OS2 — CID 2741579
N-[2,6-bis(phenylsulfanyl)-3-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 2741579) has the molecular formula C22H22N2OS2 and a molecular weight of 394.57 g/mol. Its IUPAC name is N-[2,6-bis(phenylsulfanyl)-3-pyridinyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2,6-bis(phenylsulfanyl)-3-pyridinyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 2741579 |
| Molecular Formula | C22H22N2OS2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-[2,6-bis(phenylsulfanyl)-3-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(Sc2ccccc2)nc1Sc1ccccc1 |
| InChI | InChI=1S/C22H22N2OS2/c1-22(2,3)21(25)23-18-14-15-19(26-16-10-6-4-7-11-16)24-20(18)27-17-12-8-5-9-13-17/h4-15H,1-3H3,(H,23,25) |
| InChIKey | FCISTJNKJHPDMD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |