C20H19BrN2OS — CID 141418907
N-[5-(4-bromophenyl)sulfanylquinolin-8-yl]-2,2-dimethylpropanamide (PubChem CID 141418907) has the molecular formula C20H19BrN2OS and a molecular weight of 415.36 g/mol. Its IUPAC name is N-[5-(4-bromophenyl)sulfanylquinolin-8-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[5-(4-bromophenyl)sulfanylquinolin-8-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 141418907 |
| Molecular Formula | C20H19BrN2OS |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | N-[5-(4-bromophenyl)sulfanylquinolin-8-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(Sc2ccc(Br)cc2)c2cccnc12 |
| InChI | InChI=1S/C20H19BrN2OS/c1-20(2,3)19(24)23-16-10-11-17(15-5-4-12-22-18(15)16)25-14-8-6-13(21)7-9-14/h4-12H,1-3H3,(H,23,24) |
| InChIKey | OEYLRHYEZZMZDP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |