C23H24N2O — CID 141483605
2,2-dimethyl-N-[5-[2-(4-methylphenyl)ethenyl]quinolin-8-yl]propanamide (PubChem CID 141483605) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is 2,2-dimethyl-N-[5-[2-(4-methylphenyl)ethenyl]quinolin-8-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[5-[2-(4-methylphenyl)ethenyl]quinolin-8-yl]propanamide |
|---|---|
| PubChem CID | 141483605 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2,2-dimethyl-N-[5-[2-(4-methylphenyl)ethenyl]quinolin-8-yl]propanamide |
| SMILES | Cc1ccc(C=Cc2ccc(NC(=O)C(C)(C)C)c3ncccc23)cc1 |
| InChI | InChI=1S/C23H24N2O/c1-16-7-9-17(10-8-16)11-12-18-13-14-20(25-22(26)23(2,3)4)21-19(18)6-5-15-24-21/h5-15H,1-4H3,(H,25,26) |
| InChIKey | VMZFODZKLJKHQH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|