C19H14BrNO5S — CID 27418184
3-[2-[(E)-[3-(2-bromophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 27418184) has the molecular formula C19H14BrNO5S and a molecular weight of 448.29 g/mol. Its IUPAC name is 3-[2-[(E)-[3-(2-bromophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | 3-[2-[(E)-[3-(2-bromophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 27418184 |
| Molecular Formula | C19H14BrNO5S |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 446.98 |
| IUPAC Name | 3-[2-[(E)-[3-(2-bromophenyl)-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | O=C(O)CCOc1ccccc1/C=C1/SC(=O)N(c2ccccc2Br)C1=O |
| InChI | InChI=1S/C19H14BrNO5S/c20-13-6-2-3-7-14(13)21-18(24)16(27-19(21)25)11-12-5-1-4-8-15(12)26-10-9-17(22)23/h1-8,11H,9-10H2,(H,22,23)/b16-11+ |
| InChIKey | PGXOBLKATHHXBF-LFIBNONCSA-N |
| XLogP | 4.54 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|