C18H10N4S2 — CID 2742421
4-[2-[4-(thiadiazol-4-yl)phenyl]-1,3-thiazol-4-yl]benzonitrile (PubChem CID 2742421) has the molecular formula C18H10N4S2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 4-[2-[4-(thiadiazol-4-yl)phenyl]-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 4-[2-[4-(thiadiazol-4-yl)phenyl]-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 2742421 |
| Molecular Formula | C18H10N4S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 4-[2-[4-(thiadiazol-4-yl)phenyl]-1,3-thiazol-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2csc(-c3ccc(-c4csnn4)cc3)n2)cc1 |
| InChI | InChI=1S/C18H10N4S2/c19-9-12-1-3-13(4-2-12)16-10-23-18(20-16)15-7-5-14(6-8-15)17-11-24-22-21-17/h1-8,10-11H |
| InChIKey | HETJZTQPCCIZDW-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |