C21H20ClNO5S — CID 2742852
ethyl 5-(4-chlorophenyl)-2-methyl-4-[(3-methylphenyl)sulfamoyl]furan-3-carboxylate (PubChem CID 2742852) has the molecular formula C21H20ClNO5S and a molecular weight of 433.91 g/mol. Its IUPAC name is ethyl 5-(4-chlorophenyl)-2-methyl-4-[(3-methylphenyl)sulfamoyl]furan-3-carboxylate.
| Compound Name | ethyl 5-(4-chlorophenyl)-2-methyl-4-[(3-methylphenyl)sulfamoyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 2742852 |
| Molecular Formula | C21H20ClNO5S |
| Molecular Weight | 433.91 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | ethyl 5-(4-chlorophenyl)-2-methyl-4-[(3-methylphenyl)sulfamoyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc(-c2ccc(Cl)cc2)c1S(=O)(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C21H20ClNO5S/c1-4-27-21(24)18-14(3)28-19(15-8-10-16(22)11-9-15)20(18)29(25,26)23-17-7-5-6-13(2)12-17/h5-12,23H,4H2,1-3H3 |
| InChIKey | OGLQYXPKECWVFW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |