C18H14F3N3O3 — CID 2746517
N-[amino-[4-(trifluoromethyl)phenyl]methylidene]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide (PubChem CID 2746517) has the molecular formula C18H14F3N3O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is N-[amino-[4-(trifluoromethyl)phenyl]methylidene]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide.
| Compound Name | N-[amino-[4-(trifluoromethyl)phenyl]methylidene]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 2746517 |
| Molecular Formula | C18H14F3N3O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[amino-[4-(trifluoromethyl)phenyl]methylidene]-3-(2-oxo-1,3-benzoxazol-3-yl)propanamide |
| SMILES | N/C(=N\C(=O)CCn1c(=O)oc2ccccc21)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F3N3O3/c19-18(20,21)12-7-5-11(6-8-12)16(22)23-15(25)9-10-24-13-3-1-2-4-14(13)27-17(24)26/h1-8H,9-10H2,(H2,22,23,25) |
| InChIKey | QLANPQKTFSRGIK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 90.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|