C14H12Cl2N4OS — CID 2746725
[1-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]ethylideneamino]thiourea (PubChem CID 2746725) has the molecular formula C14H12Cl2N4OS and a molecular weight of 355.25 g/mol. Its IUPAC name is [1-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]ethylideneamino]thiourea.
| Compound Name | [1-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 2746725 |
| Molecular Formula | C14H12Cl2N4OS |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | [1-[4-[(3,5-dichloro-4-pyridinyl)oxy]phenyl]ethylideneamino]thiourea |
| SMILES | CC(=NNC(N)=S)c1ccc(Oc2c(Cl)cncc2Cl)cc1 |
| InChI | InChI=1S/C14H12Cl2N4OS/c1-8(19-20-14(17)22)9-2-4-10(5-3-9)21-13-11(15)6-18-7-12(13)16/h2-7H,1H3,(H3,17,20,22) |
| InChIKey | ZAKRNKMZQWVQEU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|