C25H22N4O6 — CID 2750322
ethyl 4-[(3-ethoxycarbonyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]-5-oxo-1-phenylpyrazole-3-carboxylate (PubChem CID 2750322) has the molecular formula C25H22N4O6 and a molecular weight of 474.47 g/mol. Its IUPAC name is ethyl 4-[(3-ethoxycarbonyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]-5-oxo-1-phenylpyrazole-3-carboxylate.
| Compound Name | ethyl 4-[(3-ethoxycarbonyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]-5-oxo-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 2750322 |
| Molecular Formula | C25H22N4O6 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | ethyl 4-[(3-ethoxycarbonyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]-5-oxo-1-phenylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2)C(=O)C1=CC1C(=O)N(c2ccccc2)N=C1C(=O)OCC |
| InChI | InChI=1S/C25H22N4O6/c1-3-34-24(32)20-18(22(30)28(26-20)16-11-7-5-8-12-16)15-19-21(25(33)35-4-2)27-29(23(19)31)17-13-9-6-10-14-17/h5-15,18H,3-4H2,1-2H3 |
| InChIKey | KNOPLTLNHVQOBW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 117.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|