C21H14N4O6 — CID 7053700
(4E)-4-[[(4R)-3-carboxy-5-oxo-1-phenyl-4H-pyrazol-4-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid (PubChem CID 7053700) has the molecular formula C21H14N4O6 and a molecular weight of 418.37 g/mol. Its IUPAC name is (4E)-4-[[(4R)-3-carboxy-5-oxo-1-phenyl-4H-pyrazol-4-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid.
| Compound Name | (4E)-4-[[(4R)-3-carboxy-5-oxo-1-phenyl-4H-pyrazol-4-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 7053700 |
| Molecular Formula | C21H14N4O6 |
| Molecular Weight | 418.37 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (4E)-4-[[(4R)-3-carboxy-5-oxo-1-phenyl-4H-pyrazol-4-yl]methylidene]-5-oxo-1-phenylpyrazole-3-carboxylic acid |
| SMILES | O=C(O)C1=NN(c2ccccc2)C(=O)/C1=C/[C@H]1C(=O)N(c2ccccc2)N=C1C(=O)O |
| InChI | InChI=1S/C21H14N4O6/c26-18-14(16(20(28)29)22-24(18)12-7-3-1-4-8-12)11-15-17(21(30)31)23-25(19(15)27)13-9-5-2-6-10-13/h1-11,14H,(H,28,29)(H,30,31)/b15-11+/t14-/m1/s1 |
| InChIKey | SUNPFJQXTKZFCI-XDPMZMSMSA-N |
| XLogP | 1.50 |
| TPSA | 139.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'het_5_A(7)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|