C18H12N3NaO5 — CID 59077397
sodium 4-[4-[(4-aminophenyl)methylidene]-3-carboxy-5-oxopyrazol-1-yl]benzoate (PubChem CID 59077397) has the molecular formula C18H12N3NaO5 and a molecular weight of 373.30 g/mol. Its IUPAC name is sodium 4-[4-[(4-aminophenyl)methylidene]-3-carboxy-5-oxopyrazol-1-yl]benzoate.
| Compound Name | sodium 4-[4-[(4-aminophenyl)methylidene]-3-carboxy-5-oxopyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 59077397 |
| Molecular Formula | C18H12N3NaO5 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | sodium 4-[4-[(4-aminophenyl)methylidene]-3-carboxy-5-oxopyrazol-1-yl]benzoate |
| SMILES | Nc1ccc(C=C2C(=O)N(c3ccc(C(=O)[O-])cc3)N=C2C(=O)O)cc1.[Na+] |
| InChI | InChI=1S/C18H13N3O5.Na/c19-12-5-1-10(2-6-12)9-14-15(18(25)26)20-21(16(14)22)13-7-3-11(4-8-13)17(23)24;/h1-9H,19H2,(H,23,24)(H,25,26);/q;+1/p-1 |
| InChIKey | XJXQDXZENVMICM-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|