C17H26N2O2S — CID 27511993
4-tert-butyl-N-[(Z)-[(3R)-3-methylcyclohexylidene]amino]benzenesulfonamide (PubChem CID 27511993) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 4-tert-butyl-N-[(Z)-[(3R)-3-methylcyclohexylidene]amino]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[(Z)-[(3R)-3-methylcyclohexylidene]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 27511993 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 4-tert-butyl-N-[(Z)-[(3R)-3-methylcyclohexylidene]amino]benzenesulfonamide |
| SMILES | C[C@@H]1CCC/C(=N/NS(=O)(=O)c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C17H26N2O2S/c1-13-6-5-7-15(12-13)18-19-22(20,21)16-10-8-14(9-11-16)17(2,3)4/h8-11,13,19H,5-7,12H2,1-4H3/b18-15-/t13-/m1/s1 |
| InChIKey | RVKVLFCVUNGMMT-ZLMULJHYSA-N |
| XLogP | 3.83 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|