C18H27N3O4S — CID 172552285
tert-butyl N-methyl-N-[(3Z)-3-[(4-methylphenyl)sulfonylhydrazinylidene]cyclopentyl]carbamate (PubChem CID 172552285) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(3Z)-3-[(4-methylphenyl)sulfonylhydrazinylidene]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[(3Z)-3-[(4-methylphenyl)sulfonylhydrazinylidene]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 172552285 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | tert-butyl N-methyl-N-[(3Z)-3-[(4-methylphenyl)sulfonylhydrazinylidene]cyclopentyl]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C2/CCC(N(C)C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C18H27N3O4S/c1-13-6-10-16(11-7-13)26(23,24)20-19-14-8-9-15(12-14)21(5)17(22)25-18(2,3)4/h6-7,10-11,15,20H,8-9,12H2,1-5H3/b19-14- |
| InChIKey | YDMMQJDIMLVRDI-RGEXLXHISA-N |
| XLogP | 3.05 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|