C17H22N2O2S — CID 52613203
N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-tert-butylbenzenesulfonamide (PubChem CID 52613203) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-tert-butylbenzenesulfonamide.
| Compound Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 52613203 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-[(Z)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-4-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N/N=C2/C[C@@H]3C=CC[C@H]23)cc1 |
| InChI | InChI=1S/C17H22N2O2S/c1-17(2,3)13-7-9-14(10-8-13)22(20,21)19-18-16-11-12-5-4-6-15(12)16/h4-5,7-10,12,15,19H,6,11H2,1-3H3/b18-16-/t12-,15-/m0/s1 |
| InChIKey | RUJXQYGKFDZVAC-DRDQUXLZSA-N |
| XLogP | 3.21 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|