C17H20Cl2N2O3 — CID 27520218
(3R)-1-(2,5-dichlorophenyl)-3-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione (PubChem CID 27520218) has the molecular formula C17H20Cl2N2O3 and a molecular weight of 371.26 g/mol. Its IUPAC name is (3R)-1-(2,5-dichlorophenyl)-3-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(2,5-dichlorophenyl)-3-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 27520218 |
| Molecular Formula | C17H20Cl2N2O3 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (3R)-1-(2,5-dichlorophenyl)-3-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCCC[C@H]2CCO)C(=O)N1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H20Cl2N2O3/c18-11-4-5-13(19)14(9-11)21-16(23)10-15(17(21)24)20-7-2-1-3-12(20)6-8-22/h4-5,9,12,15,22H,1-3,6-8,10H2/t12-,15+/m0/s1 |
| InChIKey | OFHJHRCTFAQVMW-SWLSCSKDSA-N |
| XLogP | 2.86 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|