C19H26N2O3 — CID 6354366
(3S)-1-(4-ethylphenyl)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione (PubChem CID 6354366) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3S)-1-(4-ethylphenyl)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-ethylphenyl)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6354366 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3S)-1-(4-ethylphenyl)-3-[(2R)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione |
| SMILES | CCc1ccc(N2C(=O)C[C@H](N3CCCC[C@@H]3CCO)C2=O)cc1 |
| InChI | InChI=1S/C19H26N2O3/c1-2-14-6-8-16(9-7-14)21-18(23)13-17(19(21)24)20-11-4-3-5-15(20)10-12-22/h6-9,15,17,22H,2-5,10-13H2,1H3/t15-,17+/m1/s1 |
| InChIKey | ULYWJOJGQJEMED-WBVHZDCISA-N |
| XLogP | 2.12 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|