C17H20F2N2O3 — CID 17228705
1-(3,4-difluorophenyl)-3-[2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione (PubChem CID 17228705) has the molecular formula C17H20F2N2O3 and a molecular weight of 338.35 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-(3,4-difluorophenyl)-3-[2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 17228705 |
| Molecular Formula | C17H20F2N2O3 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCCCC2CCO)C(=O)N1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H20F2N2O3/c18-13-5-4-12(9-14(13)19)21-16(23)10-15(17(21)24)20-7-2-1-3-11(20)6-8-22/h4-5,9,11,15,22H,1-3,6-8,10H2 |
| InChIKey | GQPJOMGRXBUZNH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|