C19H26N2O3 — CID 124833973
(3R)-1-(2,5-dimethylphenyl)-3-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione (PubChem CID 124833973) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is (3R)-1-(2,5-dimethylphenyl)-3-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(2,5-dimethylphenyl)-3-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 124833973 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (3R)-1-(2,5-dimethylphenyl)-3-[(2S)-2-(2-hydroxyethyl)piperidin-1-yl]pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(C)c(N2C(=O)C[C@@H](N3CCCC[C@H]3CCO)C2=O)c1 |
| InChI | InChI=1S/C19H26N2O3/c1-13-6-7-14(2)16(11-13)21-18(23)12-17(19(21)24)20-9-4-3-5-15(20)8-10-22/h6-7,11,15,17,22H,3-5,8-10,12H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | UKAGDEVGHWVEEA-DOTOQJQBSA-N |
| XLogP | 2.17 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|