C11H10N2 — CID 2752627
2,3-dimethylindole-1-carbonitrile (PubChem CID 2752627) has the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2,3-dimethylindole-1-carbonitrile.
| Compound Name | 2,3-dimethylindole-1-carbonitrile |
|---|---|
| PubChem CID | 2752627 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 2,3-dimethylindole-1-carbonitrile |
| SMILES | Cc1c(C)n(C#N)c2ccccc12 |
| InChI | InChI=1S/C11H10N2/c1-8-9(2)13(7-12)11-6-4-3-5-10(8)11/h3-6H,1-2H3 |
| InChIKey | KARKKGZHLYRKGA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |