C9H8N2OS — CID 2763638
5-methyl-2-pyridin-2-yl-1,3-thiazol-4-ol (PubChem CID 2763638) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 5-methyl-2-pyridin-2-yl-1,3-thiazol-4-ol.
| Compound Name | 5-methyl-2-pyridin-2-yl-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 2763638 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 5-methyl-2-pyridin-2-yl-1,3-thiazol-4-ol |
| SMILES | Cc1sc(-c2ccccn2)nc1O |
| InChI | InChI=1S/C9H8N2OS/c1-6-8(12)11-9(13-6)7-4-2-3-5-10-7/h2-5,12H,1H3 |
| InChIKey | KCYZXXZSLRXNOP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |