About 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide
2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide (PubChem CID 27668240) has the molecular formula C20H18N2O3S
and a molecular weight of 366.44 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide.
Molecular Properties
| Compound Name | 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide |
| PubChem CID | 27668240 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)/C=C/c2ccc(-c3ccccc3)s2)c(C)o1 |
| InChI | InChI=1S/C20H18N2O3S/c1-13-12-17(14(2)25-13)20(24)22-21-19(23)11-9-16-8-10-18(26-16)15-6-4-3-5-7-15/h3-12H,1-2H3,(H,21,23)(H,22,24)/b11-9+ |
| InChIKey | CLLDTLLKMICCFL-PKNBQFBNSA-N |
| XLogP | 4.10 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide?
The IUPAC name of 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide (CID 27668240) is 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide.
What is the SMILES notation for 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide?
The canonical SMILES for 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide is Cc1cc(C(=O)NNC(=O)/C=C/c2ccc(-c3ccccc3)s2)c(C)o1.
What is the InChIKey of 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide?
The InChIKey is CLLDTLLKMICCFL-PKNBQFBNSA-N. The full InChI is InChI=1S/C20H18N2O3S/c1-13-12-17(14(2)25-13)20(24)22-21-19(23)11-9-16-8-10-18(26-16)15-6-4-3-5-7-15/h3-12H,1-2H3,(H,21,23)(H,22,24)/b11-9+.
What are the key properties of 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide?
2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide has a molecular weight of 366.44 g/mol, XLogP of 4.10, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-N'-[(E)-3-(5-phenylthiophen-2-yl)prop-2-enoyl]furan-3-carbohydrazide is sourced from PubChem (CID 27668240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).