C19H14BrF3N2O — CID 2768171
1-(4-bromophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide (PubChem CID 2768171) has the molecular formula C19H14BrF3N2O and a molecular weight of 423.23 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide.
| Compound Name | 1-(4-bromophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 2768171 |
| Molecular Formula | C19H14BrF3N2O |
| Molecular Weight | 423.23 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 1-(4-bromophenyl)-N-[[3-(trifluoromethyl)phenyl]methyl]pyrrole-2-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1cccn1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H14BrF3N2O/c20-15-6-8-16(9-7-15)25-10-2-5-17(25)18(26)24-12-13-3-1-4-14(11-13)19(21,22)23/h1-11H,12H2,(H,24,26) |
| InChIKey | MLMDUJGLBDVVLS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.23 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |