C18H14Cl2N2O — CID 168950666
N-[(3,5-dichlorophenyl)methyl]-1-phenylpyrrole-2-carboxamide (PubChem CID 168950666) has the molecular formula C18H14Cl2N2O and a molecular weight of 345.23 g/mol. Its IUPAC name is N-[(3,5-dichlorophenyl)methyl]-1-phenylpyrrole-2-carboxamide.
| Compound Name | N-[(3,5-dichlorophenyl)methyl]-1-phenylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 168950666 |
| Molecular Formula | C18H14Cl2N2O |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-[(3,5-dichlorophenyl)methyl]-1-phenylpyrrole-2-carboxamide |
| SMILES | O=C(NCc1cc(Cl)cc(Cl)c1)c1cccn1-c1ccccc1 |
| InChI | InChI=1S/C18H14Cl2N2O/c19-14-9-13(10-15(20)11-14)12-21-18(23)17-7-4-8-22(17)16-5-2-1-3-6-16/h1-11H,12H2,(H,21,23) |
| InChIKey | KNJQKMYDWOSMNW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |