C21H15FN2O2S — CID 2769239
N-[3-cyano-4-(4-methoxyphenyl)sulfanylphenyl]-4-fluorobenzamide (PubChem CID 2769239) has the molecular formula C21H15FN2O2S and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[3-cyano-4-(4-methoxyphenyl)sulfanylphenyl]-4-fluorobenzamide.
| Compound Name | N-[3-cyano-4-(4-methoxyphenyl)sulfanylphenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 2769239 |
| Molecular Formula | C21H15FN2O2S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[3-cyano-4-(4-methoxyphenyl)sulfanylphenyl]-4-fluorobenzamide |
| SMILES | COc1ccc(Sc2ccc(NC(=O)c3ccc(F)cc3)cc2C#N)cc1 |
| InChI | InChI=1S/C21H15FN2O2S/c1-26-18-7-9-19(10-8-18)27-20-11-6-17(12-15(20)13-23)24-21(25)14-2-4-16(22)5-3-14/h2-12H,1H3,(H,24,25) |
| InChIKey | XMJFNTXDVNBXCU-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |