C7H16Cl5N3 — CID 2770081
2,2,2-trichloro-N'-[3-(dimethylamino)propyl]ethanimidamide;dihydrochloride (PubChem CID 2770081) has the molecular formula C7H16Cl5N3 and a molecular weight of 319.49 g/mol. Its IUPAC name is 2,2,2-trichloro-N'-[3-(dimethylamino)propyl]ethanimidamide;dihydrochloride.
| Compound Name | 2,2,2-trichloro-N'-[3-(dimethylamino)propyl]ethanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 2770081 |
| Molecular Formula | C7H16Cl5N3 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 316.98 |
| IUPAC Name | 2,2,2-trichloro-N'-[3-(dimethylamino)propyl]ethanimidamide;dihydrochloride |
| SMILES | CN(C)CCC/N=C(\N)C(Cl)(Cl)Cl.Cl.Cl |
| InChI | InChI=1S/C7H14Cl3N3.2ClH/c1-13(2)5-3-4-12-6(11)7(8,9)10;;/h3-5H2,1-2H3,(H2,11,12);2*1H |
| InChIKey | BPXLEPAXVGXRRR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|