About 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole
4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole (PubChem CID 2773117) has the molecular formula C14H10N4
and a molecular weight of 234.26 g/mol. Its IUPAC name is 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole.
Molecular Properties
| Compound Name | 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole |
| PubChem CID | 2773117 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole |
| SMILES | c1ccc(-n2c3ccccc3n3cnnc23)cc1 |
| InChI | InChI=1S/C14H10N4/c1-2-6-11(7-3-1)18-13-9-5-4-8-12(13)17-10-15-16-14(17)18/h1-10H |
| InChIKey | PWISJQNPNAAKOW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole?
The IUPAC name of 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole (CID 2773117) is 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole.
What is the SMILES notation for 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole?
The canonical SMILES for 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole is c1ccc(-n2c3ccccc3n3cnnc23)cc1.
What is the InChIKey of 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole?
The InChIKey is PWISJQNPNAAKOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N4/c1-2-6-11(7-3-1)18-13-9-5-4-8-12(13)17-10-15-16-14(17)18/h1-10H.
What are the key properties of 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole?
4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole has a molecular weight of 234.26 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-[1,2,4]triazolo[4,3-a]benzimidazole is sourced from PubChem (CID 2773117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).