C17H15N3O3S2 — CID 2777592
ethyl 2-[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylanilino]-2-oxoacetate (PubChem CID 2777592) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is ethyl 2-[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 2777592 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | ethyl 2-[2-(7-methylthieno[3,2-d]pyrimidin-4-yl)sulfanylanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1ccccc1Sc1ncnc2c(C)csc12 |
| InChI | InChI=1S/C17H15N3O3S2/c1-3-23-17(22)15(21)20-11-6-4-5-7-12(11)25-16-14-13(18-9-19-16)10(2)8-24-14/h4-9H,3H2,1-2H3,(H,20,21) |
| InChIKey | GLLXUIYMICWULS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|