C23H30N4O2 — CID 27786498
(5S,7R)-3-acetamido-N-[3-(benzimidazol-1-yl)propyl]adamantane-1-carboxamide (PubChem CID 27786498) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is (5S,7R)-3-acetamido-N-[3-(benzimidazol-1-yl)propyl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-acetamido-N-[3-(benzimidazol-1-yl)propyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 27786498 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (5S,7R)-3-acetamido-N-[3-(benzimidazol-1-yl)propyl]adamantane-1-carboxamide |
| SMILES | CC(=O)NC12C[C@H]3C[C@@H](C1)CC(C(=O)NCCCn1cnc4ccccc41)(C3)C2 |
| InChI | InChI=1S/C23H30N4O2/c1-16(28)26-23-12-17-9-18(13-23)11-22(10-17,14-23)21(29)24-7-4-8-27-15-25-19-5-2-3-6-20(19)27/h2-3,5-6,15,17-18H,4,7-14H2,1H3,(H,24,29)(H,26,28)/t17-,18+,22?,23? |
| InChIKey | DDQIELBPMLZRJA-WVKNIADZSA-N |
| XLogP | 3.02 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|