C14H11F3N4O2 — CID 27786711
N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyrazine-2-carboxamide (PubChem CID 27786711) has the molecular formula C14H11F3N4O2 and a molecular weight of 324.26 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyrazine-2-carboxamide.
| Compound Name | N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 27786711 |
| Molecular Formula | C14H11F3N4O2 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | N-methyl-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]pyrazine-2-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(F)c(F)c1F)C(=O)c1cnccn1 |
| InChI | InChI=1S/C14H11F3N4O2/c1-21(14(23)10-6-18-4-5-19-10)7-11(22)20-9-3-2-8(15)12(16)13(9)17/h2-6H,7H2,1H3,(H,20,22) |
| InChIKey | UNLQZWSOEUXHAV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|