C22H20F2N2O3 — CID 27794966
N-[2-(3-fluoroanilino)-2-oxoethyl]-3-[5-(2-fluorophenyl)furan-2-yl]-N-methylpropanamide (PubChem CID 27794966) has the molecular formula C22H20F2N2O3 and a molecular weight of 398.41 g/mol. Its IUPAC name is N-[2-(3-fluoroanilino)-2-oxoethyl]-3-[5-(2-fluorophenyl)furan-2-yl]-N-methylpropanamide.
| Compound Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-3-[5-(2-fluorophenyl)furan-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 27794966 |
| Molecular Formula | C22H20F2N2O3 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-3-[5-(2-fluorophenyl)furan-2-yl]-N-methylpropanamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)C(=O)CCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C22H20F2N2O3/c1-26(14-21(27)25-16-6-4-5-15(23)13-16)22(28)12-10-17-9-11-20(29-17)18-7-2-3-8-19(18)24/h2-9,11,13H,10,12,14H2,1H3,(H,25,27) |
| InChIKey | DUKQYZJCWPECOP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |