C22H20FN3O4 — CID 46442616
N-(2-amino-2-oxoethyl)-3-[3-[5-(2-fluorophenyl)furan-2-yl]propanoylamino]benzamide (PubChem CID 46442616) has the molecular formula C22H20FN3O4 and a molecular weight of 409.42 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-3-[3-[5-(2-fluorophenyl)furan-2-yl]propanoylamino]benzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-3-[3-[5-(2-fluorophenyl)furan-2-yl]propanoylamino]benzamide |
|---|---|
| PubChem CID | 46442616 |
| Molecular Formula | C22H20FN3O4 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-3-[3-[5-(2-fluorophenyl)furan-2-yl]propanoylamino]benzamide |
| SMILES | NC(=O)CNC(=O)c1cccc(NC(=O)CCc2ccc(-c3ccccc3F)o2)c1 |
| InChI | InChI=1S/C22H20FN3O4/c23-18-7-2-1-6-17(18)19-10-8-16(30-19)9-11-21(28)26-15-5-3-4-14(12-15)22(29)25-13-20(24)27/h1-8,10,12H,9,11,13H2,(H2,24,27)(H,25,29)(H,26,28) |
| InChIKey | WAURPWXMLPXREG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |