C25H26FN3O4 — CID 55526476
3-[5-(2-fluorophenyl)furan-2-yl]-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]propanamide (PubChem CID 55526476) has the molecular formula C25H26FN3O4 and a molecular weight of 451.50 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)furan-2-yl]-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]propanamide.
| Compound Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]propanamide |
|---|---|
| PubChem CID | 55526476 |
| Molecular Formula | C25H26FN3O4 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(-c2ccccc2F)o1)Nc1ccc(NC(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C25H26FN3O4/c26-22-6-2-1-5-21(22)23-13-11-19(33-23)12-14-24(30)28-17-7-9-18(10-8-17)29-25(31)27-16-20-4-3-15-32-20/h1-2,5-11,13,20H,3-4,12,14-16H2,(H,28,30)(H2,27,29,31) |
| InChIKey | ZCNUDURVTTVFKV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |