C23H19FN4O4S — CID 24505736
3-[5-(2-fluorophenyl)furan-2-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 24505736) has the molecular formula C23H19FN4O4S and a molecular weight of 466.49 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)furan-2-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 24505736 |
| Molecular Formula | C23H19FN4O4S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | 3-[5-(2-fluorophenyl)furan-2-yl]-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCc1ccc(-c2ccccc2F)o1)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C23H19FN4O4S/c24-20-5-2-1-4-19(20)21-12-8-17(32-21)9-13-22(29)27-16-6-10-18(11-7-16)33(30,31)28-23-25-14-3-15-26-23/h1-8,10-12,14-15H,9,13H2,(H,27,29)(H,25,26,28) |
| InChIKey | ZLSFORNDBFBZKS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |