C22H20BrFN2O3 — CID 27801052
N-[2-(2-bromoanilino)-2-oxoethyl]-3-[5-(2-fluorophenyl)furan-2-yl]-N-methylpropanamide (PubChem CID 27801052) has the molecular formula C22H20BrFN2O3 and a molecular weight of 459.32 g/mol. Its IUPAC name is N-[2-(2-bromoanilino)-2-oxoethyl]-3-[5-(2-fluorophenyl)furan-2-yl]-N-methylpropanamide.
| Compound Name | N-[2-(2-bromoanilino)-2-oxoethyl]-3-[5-(2-fluorophenyl)furan-2-yl]-N-methylpropanamide |
|---|---|
| PubChem CID | 27801052 |
| Molecular Formula | C22H20BrFN2O3 |
| Molecular Weight | 459.32 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | N-[2-(2-bromoanilino)-2-oxoethyl]-3-[5-(2-fluorophenyl)furan-2-yl]-N-methylpropanamide |
| SMILES | CN(CC(=O)Nc1ccccc1Br)C(=O)CCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C22H20BrFN2O3/c1-26(14-21(27)25-19-9-5-3-7-17(19)23)22(28)13-11-15-10-12-20(29-15)16-6-2-4-8-18(16)24/h2-10,12H,11,13-14H2,1H3,(H,25,27) |
| InChIKey | TZDDUWSYBLLLKV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.32 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |