C23H20FNO5 — CID 27058522
[2-(2-acetylanilino)-2-oxoethyl] 3-[5-(2-fluorophenyl)furan-2-yl]propanoate (PubChem CID 27058522) has the molecular formula C23H20FNO5 and a molecular weight of 409.41 g/mol. Its IUPAC name is [2-(2-acetylanilino)-2-oxoethyl] 3-[5-(2-fluorophenyl)furan-2-yl]propanoate.
| Compound Name | [2-(2-acetylanilino)-2-oxoethyl] 3-[5-(2-fluorophenyl)furan-2-yl]propanoate |
|---|---|
| PubChem CID | 27058522 |
| Molecular Formula | C23H20FNO5 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [2-(2-acetylanilino)-2-oxoethyl] 3-[5-(2-fluorophenyl)furan-2-yl]propanoate |
| SMILES | CC(=O)c1ccccc1NC(=O)COC(=O)CCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C23H20FNO5/c1-15(26)17-6-3-5-9-20(17)25-22(27)14-29-23(28)13-11-16-10-12-21(30-16)18-7-2-4-8-19(18)24/h2-10,12H,11,13-14H2,1H3,(H,25,27) |
| InChIKey | FYVKIAXFDCLZMK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |