C22H19ClFNO5 — CID 55441437
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 3-[5-(2-fluorophenyl)furan-2-yl]propanoate (PubChem CID 55441437) has the molecular formula C22H19ClFNO5 and a molecular weight of 431.85 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 3-[5-(2-fluorophenyl)furan-2-yl]propanoate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 3-[5-(2-fluorophenyl)furan-2-yl]propanoate |
|---|---|
| PubChem CID | 55441437 |
| Molecular Formula | C22H19ClFNO5 |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 3-[5-(2-fluorophenyl)furan-2-yl]propanoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)CCc1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C22H19ClFNO5/c1-28-20-9-6-14(23)12-18(20)25-21(26)13-29-22(27)11-8-15-7-10-19(30-15)16-4-2-3-5-17(16)24/h2-7,9-10,12H,8,11,13H2,1H3,(H,25,26) |
| InChIKey | KXZSOEBFMCXCNW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |