C21H19ClFNO2S — CID 2781810
1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-methyl-5-phenylpyrrole-3-carboxylic acid (PubChem CID 2781810) has the molecular formula C21H19ClFNO2S and a molecular weight of 403.91 g/mol. Its IUPAC name is 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-methyl-5-phenylpyrrole-3-carboxylic acid.
| Compound Name | 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-methyl-5-phenylpyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 2781810 |
| Molecular Formula | C21H19ClFNO2S |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-methyl-5-phenylpyrrole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)cc(-c2ccccc2)n1CCSCc1c(F)cccc1Cl |
| InChI | InChI=1S/C21H19ClFNO2S/c1-14-16(21(25)26)12-20(15-6-3-2-4-7-15)24(14)10-11-27-13-17-18(22)8-5-9-19(17)23/h2-9,12H,10-11,13H2,1H3,(H,25,26) |
| InChIKey | GMWHKVOTUSCEPG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|