C22H24N2O4S3 — CID 27828642
2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]-N-(3-phenylsulfanylpropyl)acetamide (PubChem CID 27828642) has the molecular formula C22H24N2O4S3 and a molecular weight of 476.65 g/mol. Its IUPAC name is 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]-N-(3-phenylsulfanylpropyl)acetamide.
| Compound Name | 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]-N-(3-phenylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 27828642 |
| Molecular Formula | C22H24N2O4S3 |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]-N-(3-phenylsulfanylpropyl)acetamide |
| SMILES | CN(c1ccc(OCC(=O)NCCCSc2ccccc2)cc1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C22H24N2O4S3/c1-24(31(26,27)22-9-5-15-30-22)18-10-12-19(13-11-18)28-17-21(25)23-14-6-16-29-20-7-3-2-4-8-20/h2-5,7-13,15H,6,14,16-17H2,1H3,(H,23,25) |
| InChIKey | TVQIXOPXAFXYIZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|