C24H29N3O4S2 — CID 41306631
N-[3-[benzyl(methyl)amino]propyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide (PubChem CID 41306631) has the molecular formula C24H29N3O4S2 and a molecular weight of 487.65 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
|---|---|
| PubChem CID | 41306631 |
| Molecular Formula | C24H29N3O4S2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-2-[4-[methyl(thiophen-2-ylsulfonyl)amino]phenoxy]acetamide |
| SMILES | CN(CCCNC(=O)COc1ccc(N(C)S(=O)(=O)c2cccs2)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H29N3O4S2/c1-26(18-20-8-4-3-5-9-20)16-7-15-25-23(28)19-31-22-13-11-21(12-14-22)27(2)33(29,30)24-10-6-17-32-24/h3-6,8-14,17H,7,15-16,18-19H2,1-2H3,(H,25,28) |
| InChIKey | PCKOIDGVGCTRAI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|