C25H26F2N2O5 — CID 27883546
2-cyclohexyl-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 27883546) has the molecular formula C25H26F2N2O5 and a molecular weight of 472.49 g/mol. Its IUPAC name is 2-cyclohexyl-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-cyclohexyl-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 27883546 |
| Molecular Formula | C25H26F2N2O5 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-cyclohexyl-N-[2-[4-(difluoromethoxy)-3-methoxyphenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | COc1cc(CCNC(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)ccc1OC(F)F |
| InChI | InChI=1S/C25H26F2N2O5/c1-33-21-13-15(7-10-20(21)34-25(26)27)11-12-28-22(30)16-8-9-18-19(14-16)24(32)29(23(18)31)17-5-3-2-4-6-17/h7-10,13-14,17,25H,2-6,11-12H2,1H3,(H,28,30) |
| InChIKey | AMLRQCBEWQYKKP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|