C27H26F3N3O6S — CID 91937770
7,8-dimethoxy-5-[[[1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]amino]methyl]benzo[e]isoindole-1,3-dione (PubChem CID 91937770) has the molecular formula C27H26F3N3O6S and a molecular weight of 577.58 g/mol. Its IUPAC name is 7,8-dimethoxy-5-[[[1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]amino]methyl]benzo[e]isoindole-1,3-dione.
| Compound Name | 7,8-dimethoxy-5-[[[1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]amino]methyl]benzo[e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91937770 |
| Molecular Formula | C27H26F3N3O6S |
| Molecular Weight | 577.58 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | 7,8-dimethoxy-5-[[[1-[4-(trifluoromethyl)phenyl]sulfonylpiperidin-4-yl]amino]methyl]benzo[e]isoindole-1,3-dione |
| SMILES | COc1cc2c(CNC3CCN(S(=O)(=O)c4ccc(C(F)(F)F)cc4)CC3)cc3c(c2cc1OC)C(=O)NC3=O |
| InChI | InChI=1S/C27H26F3N3O6S/c1-38-22-12-19-15(11-21-24(26(35)32-25(21)34)20(19)13-23(22)39-2)14-31-17-7-9-33(10-8-17)40(36,37)18-5-3-16(4-6-18)27(28,29)30/h3-6,11-13,17,31H,7-10,14H2,1-2H3,(H,32,34,35) |
| InChIKey | WWANNNBHYFIOSH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|