C27H29N3O6S — CID 91937766
7,8-dimethoxy-5-[[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]amino]methyl]benzo[e]isoindole-1,3-dione (PubChem CID 91937766) has the molecular formula C27H29N3O6S and a molecular weight of 523.61 g/mol. Its IUPAC name is 7,8-dimethoxy-5-[[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]amino]methyl]benzo[e]isoindole-1,3-dione.
| Compound Name | 7,8-dimethoxy-5-[[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]amino]methyl]benzo[e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91937766 |
| Molecular Formula | C27H29N3O6S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 7,8-dimethoxy-5-[[[1-(4-methylphenyl)sulfonylpiperidin-4-yl]amino]methyl]benzo[e]isoindole-1,3-dione |
| SMILES | COc1cc2c(CNC3CCN(S(=O)(=O)c4ccc(C)cc4)CC3)cc3c(c2cc1OC)C(=O)NC3=O |
| InChI | InChI=1S/C27H29N3O6S/c1-16-4-6-19(7-5-16)37(33,34)30-10-8-18(9-11-30)28-15-17-12-22-25(27(32)29-26(22)31)21-14-24(36-3)23(35-2)13-20(17)21/h4-7,12-14,18,28H,8-11,15H2,1-3H3,(H,29,31,32) |
| InChIKey | ZHPCUAUMURSEIS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|